For research use only. Not for therapeutic Use.
Voreloxin hydrochloride(Cat No.:I002288)is an antineoplastic agent that belongs to the class of drugs known as topoisomerase inhibitors. It specifically targets topoisomerase II, an enzyme critical for DNA replication and cell division, by stabilizing the enzyme-DNA complex, leading to DNA damage and subsequent cancer cell apoptosis. Voreloxin has been primarily studied for its effectiveness in treating acute myeloid leukemia (AML) and other hematological malignancies. Its mechanism of action and favorable pharmacokinetic profile make it a promising candidate for combination therapies, enhancing the effectiveness of existing chemotherapy regimens.
CAS Number | 175519-16-1 |
Synonyms | 7-[(3S,4S)-3-methoxy-4-(methylamino)pyrrolidin-1-yl]-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylic acid;hydrochloride |
Molecular Formula | C18H20ClN5O4S |
Purity | ≥95% |
Target | Apoptosis |
Solubility | 10 mM in DMSO |
Storage | Store at -20°C |
IUPAC Name | 7-[(3S,4S)-3-methoxy-4-(methylamino)pyrrolidin-1-yl]-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylic acid;hydrochloride |
InChI | InChI=1S/C18H19N5O4S.ClH/c1-19-12-8-22(9-13(12)27-2)14-4-3-10-15(24)11(17(25)26)7-23(16(10)21-14)18-20-5-6-28-18;/h3-7,12-13,19H,8-9H2,1-2H3,(H,25,26);1H/t12-,13-;/m0./s1 |
InChIKey | JJZCCQHWCOXGCL-QNTKWALQSA-N |
SMILES | CN[C@H]1CN(C[C@@H]1OC)C2=NC3=C(C=C2)C(=O)C(=CN3C4=NC=CS4)C(=O)O.Cl |
Reference | <p style=/line-height:25px/> |