For research use only. Not for therapeutic Use.
Voriconazole-d3(Cat No.:S000318) is a deuterated form of voriconazole, where three hydrogen atoms are replaced with deuterium. Voriconazole is an antifungal medication primarily used to treat serious, invasive fungal infections such as aspergillosis and candidiasis. The introduction of deuterium increases the stability of the molecule, facilitating more accurate pharmacokinetic and metabolic analyses. This isotopic labeling allows for detailed tracking of voriconazole’s behavior within the body, enhancing understanding of its absorption, distribution, metabolism, and elimination.
Catalog Number | S000318 |
CAS Number | 1217661-14-7 |
Molecular Formula | C16H11D3F3N5O |
Purity | ≥95% |
IUPAC Name | (2R,3S)-4,4,4-trideuterio-2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol |
InChI | InChI=1S/C16H14F3N5O/c1-10(15-14(19)5-20-7-22-15)16(25,6-24-9-21-8-23-24)12-3-2-11(17)4-13(12)18/h2-5,7-10,25H,6H2,1H3/t10-,16+/m0/s1/i1D3 |
InChIKey | BCEHBSKCWLPMDN-QLWAGJNOSA-N |
SMILES | CC(C1=NC=NC=C1F)C(CN2C=NC=N2)(C3=C(C=C(C=C3)F)F)O |