For research use only. Not for therapeutic Use.
Vorolanib is a tyrosine kinase inhibitor that targets vascular endothelial growth factor receptors (VEGFR), platelet-derived growth factor receptors (PDGFR), and fibroblast growth factor receptors (FGFR). It is primarily investigated for its potential in treating various cancers by inhibiting angiogenesis, the process through which tumors develop their blood supply. By blocking these key pathways, vorolanib aims to reduce tumor growth and metastasis. It is also studied for its application in ocular diseases, such as age-related macular degeneration (AMD), where abnormal blood vessel growth is a concern.
| Catalog Number | I010044 |
| CAS Number | 1013920-15-4 |
| Synonyms | N-[(3S)-1-(dimethylcarbamoyl)pyrrolidin-3-yl]-5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide |
| Molecular Formula | C23H26FN5O3 |
| Purity | ≥95% |
| InChI | InChI=1S/C23H26FN5O3/c1-12-19(10-17-16-9-14(24)5-6-18(16)27-21(17)30)25-13(2)20(12)22(31)26-15-7-8-29(11-15)23(32)28(3)4/h5-6,9-10,15,25H,7-8,11H2,1-4H3,(H,26,31)(H,27,30)/b17-10-/t15-/m0/s1 |
| InChIKey | KMIOJWCYOHBUJS-HAKPAVFJSA-N |
| SMILES | CC1=C(NC(=C1C(=O)NC2CCN(C2)C(=O)N(C)C)C)C=C3C4=C(C=CC(=C4)F)NC3=O |
