For research use only. Not for therapeutic Use.
VPC-13566(Cat No.:I012024)is a selective and potent inhibitor of the vascular endothelial growth factor receptor (VEGFR) 2, which plays a crucial role in angiogenesis, the process of new blood vessel formation. By targeting VEGFR2, VPC-13566 aims to inhibit tumor-induced blood vessel growth, thus reducing the supply of oxygen and nutrients to cancerous tumors. This makes it a promising candidate for cancer therapies, particularly in targeting solid tumors. Research continues to evaluate its safety, efficacy, and potential as part of combination therapy in oncology, aiming to improve treatment outcomes for patients with various cancers.
CAS Number | 218464-59-6 |
Synonyms | 2-(7-methyl-1H-indol-3-yl)quinoline |
Molecular Formula | C18H14N2 |
Purity | ≥95% |
IUPAC Name | 2-(7-methyl-1H-indol-3-yl)quinoline |
InChI | InChI=1S/C18H14N2/c1-12-5-4-7-14-15(11-19-18(12)14)17-10-9-13-6-2-3-8-16(13)20-17/h2-11,19H,1H3 |
InChIKey | FPKBNOVQNMJTEJ-UHFFFAOYSA-N |
SMILES | CC1=C2C(=CC=C1)C(=CN2)C3=NC4=CC=CC=C4C=C3 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |