For research use only. Not for therapeutic Use.
VRT752271（Cat No.:I005233）is a potent and selective inhibitor of the enzyme phosphoinositide 3-kinase δ (PI3Kδ), a key component of the PI3K/Akt signaling pathway involved in immune cell activation, proliferation, and survival. By inhibiting PI3Kδ, VRT752271 effectively suppresses the signaling processes responsible for B-cell activation, making it valuable in the treatment of B-cell malignancies and autoimmune diseases. It has been used in preclinical studies to explore PI3Kδ’s role in cancers like lymphoma and leukemia, as well as in conditions where immune modulation is crucial, providing insights for targeted therapies.
| Catalog Number | I005233 |
| CAS Number | 869886-67-9 |
| Synonyms | N-[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]-4-[5-chloro-2-(propan-2-ylamino)pyridin-4-yl]-1H-pyrrole-2-carboxamide |
| Molecular Formula | C₂₁H₂₂Cl₂N₄O₂ |
| Purity | ≥95% |
| Target | ERK |
| Solubility | DMSO: ≥ 45 mg/mL |
| Storage | Store at -20C |
| IUPAC Name | N-[(1S)-1-(3-chlorophenyl)-2-hydroxyethyl]-4-[5-chloro-2-(propan-2-ylamino)pyridin-4-yl]-1H-pyrrole-2-carboxamide |
| InChI | InChI=1S/C21H22Cl2N4O2/c1-12(2)26-20-8-16(17(23)10-25-20)14-7-18(24-9-14)21(29)27-19(11-28)13-4-3-5-15(22)6-13/h3-10,12,19,24,28H,11H2,1-2H3,(H,25,26)(H,27,29)/t19-/m1/s1 |
| InChIKey | KSERXGMCDHOLSS-LJQANCHMSA-N |
| SMILES | CC(C)NC1=NC=C(C(=C1)C2=CNC(=C2)C(=O)N[C@H](CO)C3=CC(=CC=C3)Cl)Cl |
| Reference | <p style=/line-height:25px/> |
