For research use only. Not for therapeutic Use.
VT-1598（Cat No.:I042955）is a selective, orally bioavailable inhibitor developed to target specific signaling pathways involved in immune modulation and oncology. It acts by inhibiting the enzyme IDO1 (indoleamine 2,3-dioxygenase 1), which plays a role in immune suppression and tumor immune evasion. By blocking IDO1, VT-1598 enhances anti-tumor immunity and has shown potential in combination therapies for cancer treatment. It is being investigated for its therapeutic applications in immuno-oncology, offering a novel approach to boosting the body’s immune response against various malignancies and other immune-related conditions.
| CAS Number | 2089320-99-8 |
| Synonyms | 4-[[4-[2-[6-[(2R)-2-(2,4-difluorophenyl)-1,1-difluoro-2-hydroxy-3-(tetrazol-1-yl)propyl]pyridin-3-yl]ethynyl]phenoxy]methyl]benzonitrile |
| Molecular Formula | C31H20F4N6O2 |
| Purity | ≥95% |
| IUPAC Name | 4-[[4-[2-[6-[(2R)-2-(2,4-difluorophenyl)-1,1-difluoro-2-hydroxy-3-(tetrazol-1-yl)propyl]pyridin-3-yl]ethynyl]phenoxy]methyl]benzonitrile |
| InChI | InChI=1S/C31H20F4N6O2/c32-25-10-13-27(28(33)15-25)30(42,19-41-20-38-39-40-41)31(34,35)29-14-9-23(17-37-29)4-1-21-7-11-26(12-8-21)43-18-24-5-2-22(16-36)3-6-24/h2-3,5-15,17,20,42H,18-19H2/t30-/m0/s1 |
| InChIKey | UDGASIIGNCBLSI-PMERELPUSA-N |
| SMILES | C1=CC(=CC=C1COC2=CC=C(C=C2)C#CC3=CN=C(C=C3)C([C@](CN4C=NN=N4)(C5=C(C=C(C=C5)F)F)O)(F)F)C#N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
