For research use only. Not for therapeutic Use.
VU0364572 TFA(Cat No.:I011317)is a potent and selective inhibitor of the protein kinase C (PKC) signaling pathway, specifically targeting the PKCα isoform. It is primarily used in preclinical research to investigate the role of PKCα in various cellular processes, such as growth, differentiation, and apoptosis. By inhibiting PKCα, VU0364572 TFA has potential applications in studying cancer, inflammation, and other diseases where PKCα activity plays a critical role. The compound is typically used to better understand the therapeutic targeting of PKCα in disease models, with ongoing research exploring its broader therapeutic potential.
CAS Number | 1240514-89-9 |
Synonyms | ethyl 4-[(3R)-3-[(2-methylbenzoyl)amino]piperidin-1-yl]piperidine-1-carboxylate;2,2,2-trifluoroacetic acid |
Molecular Formula | C23H32F3N3O5 |
Purity | ≥95% |
IUPAC Name | ethyl 4-[(3R)-3-[(2-methylbenzoyl)amino]piperidin-1-yl]piperidine-1-carboxylate;2,2,2-trifluoroacetic acid |
InChI | InChI=1S/C21H31N3O3.C2HF3O2/c1-3-27-21(26)23-13-10-18(11-14-23)24-12-6-8-17(15-24)22-20(25)19-9-5-4-7-16(19)2;3-2(4,5)1(6)7/h4-5,7,9,17-18H,3,6,8,10-15H2,1-2H3,(H,22,25);(H,6,7)/t17-;/m1./s1 |
InChIKey | QEFQJTFXOBPBLZ-UNTBIKODSA-N |
SMILES | CCOC(=O)N1CCC(CC1)N2CCC[C@H](C2)NC(=O)C3=CC=CC=C3C.C(=O)(C(F)(F)F)O |