For research use only. Not for therapeutic Use.
VU0364770(CAT: I004318) is a selective allosteric modulator of metabotropic glutamate receptor 4 (mGlu4), a receptor involved in regulating synaptic transmission and neuronal excitability. By modulating mGlu4 activity, VU0364770 enhances glutamatergic signaling in a receptor-specific manner without directly activating the receptor. This compound is particularly valuable in neuropharmacology research, supporting the study of mGlu4’s role in neurodegenerative diseases, such as Parkinson’s disease, and in psychiatric disorders. Its high selectivity and efficacy make it a critical tool for exploring therapeutic strategies targeting mGlu4-mediated pathways and for advancing drug discovery efforts focused on allosteric modulation of glutamate receptors.
| Catalog Number | I004318 |
| CAS Number | 61350-00-3 |
| Synonyms | N-(3-chlorophenyl)pyridine-2-carboxamide |
| Molecular Formula | C12H9ClN2O |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | 10 mM in DMSO |
| Storage | 3 years -20C powder |
| IUPAC Name | N-(3-chlorophenyl)pyridine-2-carboxamide |
| InChI | InChI=1S/C12H9ClN2O/c13-9-4-3-5-10(8-9)15-12(16)11-6-1-2-7-14-11/h1-8H,(H,15,16) |
| InChIKey | SUYUTNCKIOLMAJ-UHFFFAOYSA-N |
| SMILES | ClC1=CC(NC(C2=NC=CC=C2)=O)=CC=C1 |
