For research use only. Not for therapeutic Use.
VUF10460 is a small molecule compound that acts as an agonist for the histamine H4 receptor. It has been shown to selectively activate H4 receptors, which are involved in various physiological and pathological processes, such as inflammation, immune responses, and pruritus. VUF10460 has been studied for its potential therapeutic use in various conditions, such as allergies, asthma, and autoimmune diseases.
| Catalog Number | I011024 |
| CAS Number | 1028327-66-3 |
| Synonyms | 4-(4-Methyl-1-piperazinyl)-6-phenyl-2-Pyrimidinamine |
| Molecular Formula | C15H19N5 |
| Purity | ≥95% |
| Target | Histamine Receptor |
| Solubility | Soluble to 100 mM in DMSO and to 100 mM in 2eq.HCl |
| Storage | 2–8 °C |
| IUPAC Name | 4-(4-methylpiperazin-1-yl)-6-phenylpyrimidin-2-amine |
| InChI | InChI=1S/C15H19N5/c1-19-7-9-20(10-8-19)14-11-13(17-15(16)18-14)12-5-3-2-4-6-12/h2-6,11H,7-10H2,1H3,(H2,16,17,18) |
| InChIKey | NIJGWJIOMPHDBP-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=NC(=NC(=C2)C3=CC=CC=C3)N |
