For research use only. Not for therapeutic Use.
Vulolisib（Cat No.:I043357）is a selective, small-molecule inhibitor targeting the PI3Kδ (phosphoinositide 3-kinase delta) enzyme, which plays a crucial role in immune cell signaling. By inhibiting this pathway, Vulolisib can modulate immune responses and is being investigated for its potential in treating autoimmune diseases, hematological cancers, and other immune-related disorders. Its action helps in reducing the proliferation and survival of certain immune cells, offering a targeted approach to diseases driven by abnormal immune system activity. Vulolisib is an important candidate in the field of immuno-oncology and immunotherapy research.
| CAS Number | 2390105-79-8 |
| Synonyms | (2S)-2-[[2-[(4R)-4-(difluoromethyl)-2-oxo-1,3-thiazolidin-3-yl]-5,6-dihydroimidazo[1,2-d][1,4]benzoxazepin-9-yl]amino]propanamide |
| Molecular Formula | C18H19F2N5O3S |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-[[2-[(4R)-4-(difluoromethyl)-2-oxo-1,3-thiazolidin-3-yl]-5,6-dihydroimidazo[1,2-d][1,4]benzoxazepin-9-yl]amino]propanamide |
| InChI | InChI=1S/C18H19F2N5O3S/c1-9(16(21)26)22-10-2-3-11-13(6-10)28-5-4-24-7-14(23-17(11)24)25-12(15(19)20)8-29-18(25)27/h2-3,6-7,9,12,15,22H,4-5,8H2,1H3,(H2,21,26)/t9-,12-/m0/s1 |
| InChIKey | KEEKMOIRJUWKNK-CABZTGNLSA-N |
| SMILES | C[C@@H](C(=O)N)NC1=CC2=C(C=C1)C3=NC(=CN3CCO2)N4[C@@H](CSC4=O)C(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
