For research use only. Not for therapeutic Use.
Vulpinic acid（Cat No.:R000484）is a bioactive compound found in certain lichen species, particularly in the genus Letharia. It exhibits a range of biological activities, including antimicrobial, anticancer, and antioxidant properties. Vulpinic acid has been shown to inhibit the growth of various bacterial and fungal strains, making it a potential candidate for natural antimicrobial drug development. Additionally, its ability to scavenge free radicals suggests it may have therapeutic potential in combating oxidative stress-related diseases. Research is ongoing to explore its full pharmacological potential, including its role in cancer and inflammation treatment.
| CAS Number | 521-52-8 |
| Synonyms | methyl (2E)-2-(3-hydroxy-5-oxo-4-phenylfuran-2-ylidene)-2-phenylacetate |
| Molecular Formula | C19H14O5 |
| Purity | ≥95% |
| IUPAC Name | methyl (2E)-2-(3-hydroxy-5-oxo-4-phenylfuran-2-ylidene)-2-phenylacetate |
| InChI | InChI=1S/C19H14O5/c1-23-18(21)15(13-10-6-3-7-11-13)17-16(20)14(19(22)24-17)12-8-4-2-5-9-12/h2-11,20H,1H3/b17-15+ |
| InChIKey | OMZRMXULWNMRAE-BMRADRMJSA-N |
| SMILES | COC(=O)/C(=C/1\C(=C(C(=O)O1)C2=CC=CC=C2)O)/C3=CC=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
