For research use only. Not for therapeutic Use.
VUN65671（Cat No.:I038220）is a selective and potent inhibitor of the Ebola virus protease, a critical enzyme in the replication cycle of the virus. Its mechanism of action involves binding to the active site of the protease, blocking its function and preventing the cleavage of viral polyproteins, which is essential for viral maturation. This inhibition halts the replication of the virus, making VUN65671 a promising candidate for therapeutic development against Ebola virus infections. It demonstrates strong antiviral efficacy and is being investigated in preclinical and clinical studies for its potential role in treating viral outbreaks.
| Catalog Number | I038220 |
| CAS Number | 2479465-67-1 |
| Synonyms | VUN65671; VUN-65671; VUN 65671; |
| Molecular Formula | C25H30F3N3O2 |
| Purity | 98% |
| Target | Filovirus |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | N-[4-(4-methylpiperidin-1-yl)-3-(trifluoromethyl)phenyl]-4-(morpholin-4-ylmethyl)benzamide |
| InChI | InChI=1S/C25H30F3N3O2/c1-18-8-10-31(11-9-18)23-7-6-21(16-22(23)25(26,27)28)29-24(32)20-4-2-19(3-5-20)17-30-12-14-33-15-13-30/h2-7,16,18H,8-15,17H2,1H3,(H,29,32) |
| InChIKey | VVJSZYWIEBDKTC-UHFFFAOYSA-N |
| SMILES | CC1CCN(CC1)C2=C(C=C(C=C2)NC(=O)C3=CC=C(C=C3)CN4CCOCC4)C(F)(F)F |
| Reference | Journal of Medicinal Chemistry (2020), 63(13), 7211-7225. |
