For research use only. Not for therapeutic Use.
Walrycin B(Cat No.:I005285)is a small-molecule inhibitor identified for its potential in antibacterial therapy, particularly against pathogens involved in biofilm formation. It works by targeting bacterial ClpXP protease, a crucial protein complex involved in stress response and protein quality control within bacterial cells. By inhibiting ClpXP, Walrycin B disrupts protein homeostasis, leading to bacterial cell death. Its unique mechanism offers a promising approach for combating resistant bacterial strains, making it valuable in research for developing novel treatments targeting persistent infections and biofilm-associated bacteria in clinical settings.
CAS Number | 878419-78-4 |
Synonyms | 1,6-dimethyl-3-(4-(trifluoromethyl)phenyl)pyrimido[5,4-e][1,2,4]triazine-5,7(1H,6H)-dione |
Molecular Formula | C14H10F3N5O2 |
Purity | ≥95% |
Target | SARS-CoV |
Solubility | 10 mM in DMSO |
Storage | -20°C |
IC50 | 0.39 ug/ml (MIC for B. subtilis 168); 3.13 ug/ml (MIC for S. aureus N315) |
IUPAC Name | 1,6-dimethyl-3-[4-(trifluoromethyl)phenyl]pyrimido[5,4-e][1,2,4]triazine-5,7-dione |
InChI | InChI=1S/C14H10F3N5O2/c1-21-12(23)9-11(19-13(21)24)22(2)20-10(18-9)7-3-5-8(6-4-7)14(15,16)17/h3-6H,1-2H3 |
InChIKey | XRVMPTWWKLKLPB-UHFFFAOYSA-N |
SMILES | CN1C2=NC(=O)N(C(=O)C2=NC(=N1)C3=CC=C(C=C3)C(F)(F)F)C |
Reference | <p style=/line-height:25px/> |