For research use only. Not for therapeutic Use.
WAY-120491(CAT: I010072) is a pharmacological agent known for its ability to activate ATP-sensitive potassium channels. These channels play a critical role in regulating cellular membrane potential and are involved in various physiological processes, including insulin secretion, vascular tone, and neuronal excitability. By opening K-ATP channels, WAY-120491 promotes potassium efflux, leading to membrane hyperpolarization and reduced cellular excitability. This mechanism makes it valuable in cardiovascular, metabolic, and neurological research, offering insights into developing therapies for conditions such as hypertension, type 2 diabetes, and neuroprotective disorders.
CAS Number | 124916-54-7 |
Synonyms | Way-120,491; Way120491; Way-120491; Way 120491; Celikalim;2-(3-hydroxy-2,2-dimethyl-6-(trifluoromethoxy)chroman-4-yl)isoindolin-1-one |
Molecular Formula | C20H18F3NO4 |
Purity | ≥95% |
Solubility | Soluble in DMSO, not in water |
Storage | 0 - 4 °C for short term, or -20 °C for long term |
IUPAC Name | 2-[(3S,4R)-3-hydroxy-2,2-dimethyl-6-(trifluoromethoxy)-3,4-dihydrochromen-4-yl]-3H-isoindol-1-one |
InChI | InChI=1S/C20H18F3NO4/c1-19(2)17(25)16(24-10-11-5-3-4-6-13(11)18(24)26)14-9-12(27-20(21,22)23)7-8-15(14)28-19/h3-9,16-17,25H,10H2,1-2H3/t16-,17+/m1/s1 |
InChIKey | ZORATYFUTXFLJS-SJORKVTESA-N |
SMILES | CC1(C(C(C2=C(O1)C=CC(=C2)OC(F)(F)F)N3CC4=CC=CC=C4C3=O)O)C |