For research use only. Not for therapeutic Use.
Way 120744(Cat No.:I010073)is a small-molecule, selective inhibitor of the protein kinase SGK1 (serum and glucocorticoid-regulated kinase 1), which plays a role in regulating cellular processes such as ion transport, apoptosis, and metabolism. By inhibiting SGK1, Way 120744 can affect various signaling pathways involved in cell survival and stress response, making it a potential therapeutic candidate for diseases involving dysregulated SGK1 activity, such as cancer, heart disease, and inflammatory disorders. Preclinical studies have shown that Way 120744 may help in reducing tumor growth and modulating immune responses, but further research is needed.
CAS Number | 127810-07-5 |
Synonyms | Way 120744;3H-1,2,3,5-Oxathiadiazole, 4-((5-chloro-2-naphthalenyl)methyl)-, 2-oxide |
Molecular Formula | C12H9ClN2O2S |
Purity | ≥95% |
Solubility | Soluble in DMSO |
Storage | 0 - 4 °C for short term, or -20 °C for long term |
IUPAC Name | 4-[(5-chloronaphthalen-2-yl)methyl]-5H-1,2,3,5-oxathiadiazole 2-oxide |
InChI | InChI=1S/C12H9ClN2O2S/c13-11-3-1-2-9-6-8(4-5-10(9)11)7-12-14-17-18(16)15-12/h1-6H,7H2,(H,14,15) |
InChIKey | AFSHNJLKCYAWRX-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=CC(=C2)CC3=NS(=O)ON3)C(=C1)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |