For research use only. Not for therapeutic Use.
WAY-200070 is a compound that acts as a selective estrogen receptor agonist with a potency of 2.3 nM, meaning it binds to and activates estrogen receptors with high affinity. It has been studied for its potential use in treating various conditions such as osteoporosis, breast cancer, and cognitive disorders. Its selectivity for estrogen receptors may minimize side effects typically associated with non-selective estrogen receptor modulators.
| Catalog Number | I010753 |
| CAS Number | 440122-66-7 |
| Synonyms | 7-Bromo-2-(4-hydroxyphenyl)-1,3-benzoxazol-5-ol |
| Molecular Formula | C13H8BrNO3 |
| Purity | ≥95% |
| Target | Estrogen Receptor/ERR |
| Solubility | Soluble to 100 mM in DMSO and to 50 mM in ethanol |
| Storage | Store at RT |
| IUPAC Name | 7-bromo-2-(4-hydroxyphenyl)-1,3-benzoxazol-5-ol |
| InChI | InChI=1S/C13H8BrNO3/c14-10-5-9(17)6-11-12(10)18-13(15-11)7-1-3-8(16)4-2-7/h1-6,16-17H |
| InChIKey | BAAILVWEAXFTSF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC3=C(O2)C(=CC(=C3)O)Br)O |
