For research use only. Not for therapeutic Use.
WAY-232897 (Cat No.: I040456) is a selective serotonin 5-HT6 receptor agonist developed for its potential cognitive-enhancing and neuroprotective effects. The 5-HT6 receptor is primarily located in brain regions involved in learning and memory, such as the cortex and hippocampus. WAY-232897 modulates neurotransmitter systems, including acetylcholine, glutamate, and dopamine, making it a candidate for treating cognitive deficits in conditions like Alzheimer’s disease, schizophrenia, and age-related memory decline. It is primarily used in preclinical research to explore serotonergic modulation of cognitive functions.
CAS Number | 149045-58-9 |
Synonyms | N-(5-benzyl-1,3,4-thiadiazol-2-yl)-4-methoxybenzamide |
Molecular Formula | C17H15N3O2S |
Purity | ≥95% |
InChI | InChI=1S/C17H15N3O2S/c1-22-14-9-7-13(8-10-14)16(21)18-17-20-19-15(23-17)11-12-5-3-2-4-6-12/h2-10H,11H2,1H3,(H,18,20,21) |
InChIKey | CBPABUQDOXFEGT-UHFFFAOYSA-N |
SMILES | COC1=CC=C(C=C1)C(=O)NC2=NN=C(S2)CC3=CC=CC=C3 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |