For research use only. Not for therapeutic Use.
WAY-262611 is a selective, potent inhibitor of the 5-HT6 receptor, a G protein-coupled receptor involved in modulating neurotransmitter release in the brain. By targeting the 5-HT6 receptor, WAY-262611 has shown potential in treating cognitive disorders, including Alzheimer’s disease and schizophrenia, by enhancing memory and learning capabilities. Its specificity for 5-HT6 makes it a promising candidate for neurological research and drug development, particularly for therapies aimed at improving cognitive function and addressing neurodegenerative conditions.
| Catalog Number | I000464 |
| CAS Number | 1123231-07-1 |
| Synonyms | [1-(4-naphthalen-2-ylpyrimidin-2-yl)piperidin-4-yl]methanamine |
| Molecular Formula | C20H22N4 |
| Purity | ≥95% |
| Target | Wnt/β-catenin |
| Solubility | DMSO: ≥ 42 mg/mL |
| Storage | Store at -20°C |
| IC50 | 0.63 uM (EC50 in TCF-Luciferase assay) |
| IUPAC Name | [1-(4-naphthalen-2-ylpyrimidin-2-yl)piperidin-4-yl]methanamine |
| InChI | 1S/C20H22N4/c21-14-15-8-11-24(12-9-15)20-22-10-7-19(23-20)18-6-5-16-3-1-2-4-17(16)13-18/h1-7,10,13,15H,8-9,11-12,14,21H2 |
| InChIKey | QHLITPHIARVDJI-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1CN)C2=NC=CC(=N2)C3=CC4=CC=CC=C4C=C3 |
