For research use only. Not for therapeutic Use.
WCK-4234 sodium(Cat No.:I038264)is a novel antibacterial agent designed to target multi-drug-resistant bacterial infections, especially those caused by gram-negative pathogens. It functions by inhibiting key bacterial enzymes, disrupting cell wall synthesis and leading to cell death. WCK-4234 sodium shows promise against pathogens resistant to traditional antibiotics, including carbapenem-resistant strains, making it a potential option for combating hospital-acquired infections. Its potent efficacy and broad-spectrum activity are being studied in clinical trials to assess safety and effectiveness, positioning WCK-4234 sodium as a valuable candidate in the fight against antibiotic resistance.
CAS Number | 1804915-68-1 |
Synonyms | WCK-4234; WCK 4234; WCK4234. |
Molecular Formula | C7H8N3NaO5S |
Purity | 98% |
Target | Beta-lactamase |
Solubility | Soluble in DMSO |
Appearance | Solid powder |
Storage | -20°C, away from moisture |
IUPAC Name | sodium;[(2S,5R)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
InChI | InChI=1S/C7H9N3O5S.Na/c8-3-5-1-2-6-4-9(5)7(11)10(6)15-16(12,13)14;/h5-6H,1-2,4H2,(H,12,13,14);/q;+1/p-1/t5-,6+;/m0./s1 |
InChIKey | RYJWKSOILDDAHI-RIHPBJNCSA-M |
SMILES | C1C[C@H](N2C[C@@H]1N(C2=O)OS(=O)(=O)[O-])C#N.[Na+] |
Reference | 1: Papp-Wallace KM, Nguyen NQ, Jacobs MR, Bethel CR, Barnes MD, Kumar V, |