For research use only. Not for therapeutic Use.
WE 1073 is a biochemical.
| Catalog Number | I038271 |
| CAS Number | 88986-12-3 |
| Synonyms | WE 1073; WE-1073; WE1073. |
| Molecular Formula | C15H10BrClN4O2S |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | WE 1073 |
| InChI | InChI=1S/C15H10BrClN4O2S/c16-10-5-8-12(7-3-1-2-4-9(7)17)18-14(23)13-20-19-11(6-22)21(13)15(8)24-10/h1-5,14,22-23H,6H2/t14-/m0/s1 |
| InChIKey | BWIRZXDLEWQDEN-AWEZNQCLSA-N |
| SMILES | n12c([C@@H](N=C(c3c1sc(c3)Br)c1c(cccc1)Cl)O)nnc2CO |
