For research use only. Not for therapeutic Use.
WH-4-023(Cat No.:I005016)is a small molecule inhibitor that selectively targets the protein kinase CK2 (casein kinase 2), an enzyme involved in regulating various cellular processes, including cell growth, survival, and apoptosis. CK2 is often overexpressed in cancer cells and plays a role in promoting tumor growth and resistance to chemotherapy. By inhibiting CK2, WH-4-023 aims to disrupt cancer cell proliferation and enhance the effectiveness of existing cancer therapies. Preclinical studies have shown that WH-4-023 may have antitumor activity, making it a potential candidate for cancer treatment, although further clinical research is needed.
CAS Number | 837422-57-8 |
Synonyms | 2,6-dimethylphenyl (2,4-dimethoxyphenyl)(2-((4-(4-methylpiperazin-1-yl)phenyl)amino)pyrimidin-4-yl)carbamate |
Molecular Formula | C32H36N6O4 |
Purity | ≥95% |
Target | Src |
Solubility | DMSO: ≥ 46.8 mg/mL |
Storage | Desiccate at -20C |
IC50 | 2 nM/6 nM(Lck/Src) |
IUPAC Name | (2,6-dimethylphenyl) N-(2,4-dimethoxyphenyl)-N-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]carbamate |
InChI | InChI=1S/C32H36N6O4/c1-22-7-6-8-23(2)30(22)42-32(39)38(27-14-13-26(40-4)21-28(27)41-5)29-15-16-33-31(35-29)34-24-9-11-25(12-10-24)37-19-17-36(3)18-20-37/h6-16,21H,17-20H2,1-5H3,(H,33,34,35) |
InChIKey | NBTNHSGBRGTFJS-UHFFFAOYSA-N |
SMILES | CC1=C(C(=CC=C1)C)OC(=O)N(C2=C(C=C(C=C2)OC)OC)C3=NC(=NC=C3)NC4=CC=C(C=C4)N5CCN(CC5)C |
Reference | <p style=/line-height:25px/> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |