For research use only. Not for therapeutic Use.
WHI-P131(Cat No.:I002558)is a potent Janus kinase 3 (JAK3) inhibitor, known for its immunosuppressive properties. By selectively targeting JAK3, WHI-P131 blocks the JAK-STAT signaling pathway, crucial for the development and function of immune cells. This inhibition helps prevent immune cell proliferation and activity, making WHI-P131 a valuable candidate in research focused on autoimmune diseases and transplant rejection. Its specificity and effectiveness offer potential therapeutic benefits in conditions like rheumatoid arthritis, psoriasis, and other inflammatory disorders, providing a promising approach to modulate the immune response.
Catalog Number | I002558 |
CAS Number | 202475-60-3 |
Synonyms | 4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenol |
Molecular Formula | C₁₆H₁₅N₃O₃ |
Purity | ≥95% |
Target | Stem Cell/Wnt |
Solubility | DMSO:≥ 3 mg/mL |
Storage | Store at -20°C |
IC50 | 78 uM (JAK3)[1] |
IUPAC Name | 4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenol |
InChI | InChI=1S/C16H15N3O3/c1-21-14-7-12-13(8-15(14)22-2)17-9-18-16(12)19-10-3-5-11(20)6-4-10/h3-9,20H,1-2H3,(H,17,18,19) |
InChIKey | HOZUXBLMYUPGPZ-UHFFFAOYSA-N |
SMILES | COC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC=C(C=C3)O)OC |