For research use only. Not for therapeutic Use.
WHI-P154 (Cat.No:I002626) is a promising small molecule inhibitor that has gained attention for its potential therapeutic applications. It specifically targets JAK3 and has shown efficacy in preclinical studies for various autoimmune and inflammatory diseases. Further research is ongoing to explore its clinical benefits and safety profile.
| Catalog Number | I002626 |
| CAS Number | 211555-04-3 |
| Synonyms | 2-bromo-4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenol |
| Molecular Formula | C₁₆H₁₄BrN₃O₃ |
| Purity | ≥95% |
| Target | Protein Tyrosine Kinase/RTK |
| Solubility | DMSO: ≥ 47 mg/mL |
| Storage | 3 years -20℃ powder |
| IC50 | 1.8 uM (JAK3); 4 nM(EGFR);100 nM(VEGFR) |
| IUPAC Name | 2-bromo-4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenol |
| InChI | InChI=1S/C16H14BrN3O3/c1-22-14-6-10-12(7-15(14)23-2)18-8-19-16(10)20-9-3-4-13(21)11(17)5-9/h3-8,21H,1-2H3,(H,18,19,20) |
| InChIKey | CBIAKDAYHRWZCU-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC(=C(C=C3)O)Br)OC |
