For research use only. Not for therapeutic Use.
WIC1 is a potent Wnt inhibitor. WIC1 can be used for the research of cancer[1].
WICl (10 nM, 100 nM, 10μM, 100 μM) decrease TFC/LEF luciferase reporter activity in BEAS2B cell[1].
WICl (10 nM, 100 nM, 10μM, 100 μM) shows minimal toxicity.
WICl (1μM) displays a significant reduction in ABSC proliferation[1].
WICl decreases mRNA expression of 145 known downstream Wnt signaling target genes such as CCND1, MYC, and CTNNB1[1].
WICl (1μM) decreases the nuclear localization[1].
| Catalog Number | I041148 |
| CAS Number | 943083-58-7 |
| Synonyms | N-[4-(4-ethylpiperazin-1-yl)phenyl]-2-oxochromene-3-carboxamide |
| Molecular Formula | C22H23N3O3 |
| Purity | ≥95% |
| InChI | InChI=1S/C22H23N3O3/c1-2-24-11-13-25(14-12-24)18-9-7-17(8-10-18)23-21(26)19-15-16-5-3-4-6-20(16)28-22(19)27/h3-10,15H,2,11-14H2,1H3,(H,23,26) |
| InChIKey | YQXKWSNLAVFZJL-UHFFFAOYSA-N |
| SMILES | CCN1CCN(CC1)C2=CC=C(C=C2)NC(=O)C3=CC4=CC=CC=C4OC3=O |
| Reference | [1]. Brigitte N, et al. Compositions and methods for treating cancer and improving epithelial homeostasis. Patent. WO2021133460A1. |
