For research use only. Not for therapeutic Use.
Win49375（Cat No.:I013310）is a selective and potent inhibitor of the protein kinase CK2 (Casein Kinase 2), known for its role in regulating various cellular processes such as proliferation, survival, and apoptosis. By targeting CK2, Win49375 has demonstrated potential in modulating pathways involved in cancer progression and other diseases related to abnormal kinase activity. Its inhibitory action disrupts CK2-mediated signaling, making it a valuable tool in the study of cellular signaling mechanisms and as a potential therapeutic agent for conditions where CK2 is dysregulated.
| Catalog Number | I013310 |
| CAS Number | 86393-37-5 |
| Molecular Formula | C₁₆H₁₉FN₄O₃ |
| Purity | ≥95% |
| Target | Bacterial |
| Solubility | DMSO |
| Storage | -20°C |
| IUPAC Name | 6-fluoro-1-(methylamino)-7-(4-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid |
| InChI | InChI=1S/C16H19FN4O3/c1-18-21-9-11(16(23)24)15(22)10-7-12(17)14(8-13(10)21)20-5-3-19(2)4-6-20/h7-9,18H,3-6H2,1-2H3,(H,23,24) |
| InChIKey | RUXPNBWPIRDVTH-UHFFFAOYSA-N |
| SMILES | CNN1C=C(C(=O)C2=CC(=C(C=C21)N3CCN(CC3)C)F)C(=O)O |
| Reference | [1]. Cornett JB, et al. In vitro and in vivo antibacterial activities of the fluoroquinolone WIN 49375 (amifloxacin). Antimicrob Agents Chemother. 1985 Jan;27(1):4-10.<br>[2]. Johnson JA, et al. Metabolism and disposition of amifloxacin in laboratory animals. Antimicrob Agents Chemother. 1985 May;27(5):774-81. |
