For research use only. Not for therapeutic Use.
Windorphen is a Wnt/β-catenin signal inhibitor that specifically targets the function of the c-terminal transactivation domain of β-catenin-1 but not β-catenin-2. Windorphen selectively targets p300, disrupting the association of the mammalian β-catenin with p300 but not CBP[1].
| Catalog Number | M005191 |
| CAS Number | 19881-70-0 |
| Synonyms | (Z)-3-chloro-2,3-bis(4-methoxyphenyl)prop-2-enal |
| Molecular Formula | C17H15ClO3 |
| Purity | ≥95% |
| InChI | InChI=1S/C17H15ClO3/c1-20-14-7-3-12(4-8-14)16(11-19)17(18)13-5-9-15(21-2)10-6-13/h3-11H,1-2H3/b17-16+ |
| InChIKey | VNRALGZMXHFBPG-WUKNDPDISA-N |
| SMILES | COC1=CC=C(C=C1)C(=C(C2=CC=C(C=C2)OC)Cl)C=O |
| Reference | [1]. Jijun Hao, et al. Selective small molecule targeting β-catenin function discovered by in vivo chemical genetic screen. Cell Rep. 2013 Sep 12;4(5):898-904. |
