For research use only. Not for therapeutic Use.
Wiskostatin is a potent and selective inhibitor of neuronal Wiskott-Aldrich syndrome protein (N-WASP)-mediated actin polymerization. Wiskostatin causes a rapid, profound, and irreversible decrease in cellular ATP levels[1].
| Catalog Number | R061889 |
| CAS Number | 253449-04-6 |
| Synonyms | 1-(3,6-dibromocarbazol-9-yl)-3-(dimethylamino)propan-2-ol |
| Molecular Formula | C17H18Br2N2O |
| Purity | ≥95% |
| InChI | InChI=1S/C17H18Br2N2O/c1-20(2)9-13(22)10-21-16-5-3-11(18)7-14(16)15-8-12(19)4-6-17(15)21/h3-8,13,22H,9-10H2,1-2H3 |
| InChIKey | XUBJEDZHBUPBKL-UHFFFAOYSA-N |
| SMILES | CN(C)CC(CN1C2=C(C=C(C=C2)Br)C3=C1C=CC(=C3)Br)O |
| Reference | [1]. Guerriero CJ, et al. N-WASP inhibitor wiskostatin nonselectively perturbs membrane transport by decreasing cellular ATP levels. Am J Physiol Cell Physiol. 2007;292(4):C1562-C1566. |
