For research use only. Not for therapeutic Use.
Withanolide B(CAT: I038301) is a naturally occurring steroidal lactone derived from Withania somnifera, widely studied for its pharmacological properties. Known for its potent anti-inflammatory and anticancer activities, it modulates various cellular pathways, including NF-κB and apoptosis signaling. Withanolide B is also recognized for its neuroprotective effects, making it a promising compound in neurological research. Its ability to inhibit oxidative stress and promote cytotoxicity in cancer cells underpins its potential in drug discovery. Withanolide B serves as a valuable tool for studying natural product-based therapies, providing researchers with insights into novel therapeutic mechanisms for chronic diseases and cancer treatment.
CAS Number | 56973-41-2 |
Synonyms | Withanolide B |
Molecular Formula | C28H38O5 |
Purity | 95% |
Target | Stem Cell/Wnt |
Solubility | Soluble in DMSO |
Appearance | Solid powder |
Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
IUPAC Name | (5alpha,6alpha,7alpha,22R)-5-Hydroxy-6,7:22,26-diepoxyergosta-2,24-diene-1,26-dione |
InChI | InChI=1S/C28H38O5/c1-14-13-20(32-25(30)15(14)2)16(3)17-8-9-18-22-19(10-12-26(17,18)4)27(5)21(29)7-6-11-28(27,31)24-23(22)33-24/h6-7,16-20,22-24,31H,8-13H2,1-5H3/t16-,17+,18-,19-,20+,22-,23+,24+,26+,27-,28-/m0/s1 |
InChIKey | ZTEVDTFJUUJBLP-HGSBMKTESA-N |
SMILES | CC(C[C@@H](O1)[C@@H](C)[C@H]([C@]2(CC[C@]3([H])[C@@]45C)C)CC[C@@]2([H])[C@]3([H])[C@]6([H])[C@](O6)([H])[C@@]5(O)CC=CC4=O)=C(C)C1=O |