For research use only. Not for therapeutic Use.
WL12 is the first inhibitor of JMJD6 enzymatic activity and JMJD6-dependent cell proliferations.
| Catalog Number | I038308 |
| CAS Number | 899548-78-8 |
| Synonyms | WL12; WL-12; WL 12 |
| Molecular Formula | C16H11N3O2 |
| Purity | 98% |
| Target | Histone Demethylase |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 3-(1H-Imidazo[4,5-c]pyridin-2-yl)-6-methyl-2H-chromen-2-one |
| InChI | InChI=1S/C16H11N3O2/c1-9-2-3-14-10(6-9)7-11(16(20)21-14)15-18-12-4-5-17-8-13(12)19-15/h2-8H,1H3,(H,18,19) |
| InChIKey | AFTXOIIKGOXDOT-UHFFFAOYSA-N |
| SMILES | O=C1C(C(N2)=NC3=C2C=CN=C3)=CC4=C(O1)C=CC(C)=C4 |
