WM-3835（Cat No.:I038309）is a potent and selective inhibitor of lactate dehydrogenase A (LDHA), a key enzyme involved in the conversion of pyruvate to lactate during glycolysis. By inhibiting LDHA, WM-3835 disrupts cancer cell metabolism, particularly in tumors that rely on glycolysis for energy production, commonly known as the Warburg effect. This compound has demonstrated anti-tumor activity in preclinical studies, making it a valuable tool for cancer research targeting metabolic vulnerabilities. WM-3835 holds potential for therapeutic development in cancers driven by altered metabolic pathways.
| Catalog Number | I038309 |
| CAS Number | 2229025-70-9 |
| Synonyms | WM 3835; WM3835; WM-3835; |
| Molecular Formula | C20H17FN2O4S |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | 4°C, protect from light |
| IUPAC Name | 2-fluoro-N'-(3-hydroxyphenyl)sulfonyl-3-methyl-5-phenylbenzohydrazide |
| InChI | InChI=1S/C20H17FN2O4S/c1-13-10-15(14-6-3-2-4-7-14)11-18(19(13)21)20(25)22-23-28(26,27)17-9-5-8-16(24)12-17/h2-12,23-24H,1H3,(H,22,25) |
| InChIKey | KVJFJJXCBRSCDY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1F)C(=O)NNS(=O)(=O)C2=CC=CC(=C2)O)C3=CC=CC=C3 |
