For research use only. Not for therapeutic Use.
Wnt pathway activator 2 is a potent Wnt activator extracted from patent WO2012024404A1, compound 2, has an EC50s of 13 nM[1].
| Catalog Number | I015502 |
| CAS Number | 1360540-82-4 |
| Synonyms | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-pyridin-2-ylbutane-1,4-dione |
| Molecular Formula | C17H15NO4 |
| Purity | ≥95% |
| InChI | InChI=1S/C17H15NO4/c19-14(5-6-15(20)13-3-1-2-8-18-13)12-4-7-16-17(11-12)22-10-9-21-16/h1-4,7-8,11H,5-6,9-10H2 |
| InChIKey | DMBCGEJVWBLNDP-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)C(=O)CCC(=O)C3=CC=CC=N3 |
| Reference | [1]. Charlene F. Barroga, et al. Diketones and hydroxyketones as catenin signaling pathway activators. WO2012024404A1. |
