For research use only. Not for therapeutic Use.
Wogonin（Cat No.:I004386）is a naturally occurring flavonoid derived from the roots of Scutellaria baicalensis, known for its anti-inflammatory, antioxidant, and anticancer properties. It exerts its effects by modulating various signaling pathways, including the inhibition of NF-κB, induction of apoptosis, and suppression of pro-inflammatory cytokines. Wogonin has been extensively studied for its potential in cancer research, where it promotes tumor cell death while sparing normal cells. Additionally, its neuroprotective and anti-anxiety effects make it a promising candidate for neurological and anti-inflammatory therapies.
| Catalog Number | I004386 |
| CAS Number | 632-85-9 |
| Synonyms | BRN 0287152 |
| Molecular Formula | C16H12O5 |
| Purity | ≥95% |
| Target | Stem Cell/Wnt |
| Solubility | DMSO 10 mg/ml |
| Storage | -20°C |
| IUPAC Name | 5,7-dihydroxy-8-methoxy-2-phenylchromen-4-one |
| InChI | InChI=1S/C16H12O5/c1-20-15-12(19)7-10(17)14-11(18)8-13(21-16(14)15)9-5-3-2-4-6-9/h2-8,17,19H,1H3 |
| InChIKey | XLTFNNCXVBYBSX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C2=C1OC(=CC2=O)C3=CC=CC=C3)O)O |
