For research use only. Not for therapeutic Use.
WP1066 (CAT: I005146) is a small-molecule inhibitor that exerts its pharmacologic action by targeting multiple signaling pathways, including signal transducer and activator of transcription 3 (STAT3), Janus kinase 2 (JAK2), and histone deacetylases (HDACs). By inhibiting STAT3 activation, WP1066 hinders cancer cell growth and survival. Its ability to target JAK2 and HDACs further contributes to its anti-cancer and anti-inflammatory effects. WP1066 shows promise as a potential therapeutic agent for various cancers, including glioblastoma, multiple myeloma, and breast cancer. It represents a valuable tool for targeting STAT3-driven pathways in cancer and inflammation-related conditions.
CAS Number | 857064-38-1 |
Synonyms | (E)-3-(6-bromopyridin-2-yl)-2-cyano-N-[(1S)-1-phenylethyl]prop-2-enamide |
Molecular Formula | C₁₇H₁₄BrN₃O |
Purity | ≥95% |
Target | Stem Cell/Wnt |
Solubility | DMSO: ≥ 44 mg/mL |
Storage | -20℃ |
IC50 | 2.3/2.43 uM (JAK2/STAT3) |
IUPAC Name | (E)-3-(6-bromopyridin-2-yl)-2-cyano-N-[(1S)-1-phenylethyl]prop-2-enamide |
InChI | InChI=1S/C17H14BrN3O/c1-12(13-6-3-2-4-7-13)20-17(22)14(11-19)10-15-8-5-9-16(18)21-15/h2-10,12H,1H3,(H,20,22)/b14-10+/t12-/m0/s1 |
InChIKey | VFUAJMPDXIRPKO-LQELWAHVSA-N |
SMILES | CC(C1=CC=CC=C1)NC(=O)C(=CC2=NC(=CC=C2)Br)C#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |