For research use only. Not for therapeutic Use.
WRN inhibitor 1 (example 7) is a Wemer Syndrome ATP dependent helicase enzyme (WRN) inhibitor that inhibits WRN helicase domain activity. WRN inhibitor 1 has the potential to study cancer[1].
| Catalog Number | I040921 |
| CAS Number | 2923008-44-8 |
| Synonyms | N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-6-(4-fluorophenyl)-2-oxo-1H-pyridine-3-carboxamide |
| Molecular Formula | C16H13FN2O4S |
| Purity | ≥95% |
| InChI | InChI=1S/C16H13FN2O4S/c17-11-3-1-10(2-4-11)14-6-5-13(16(21)19-14)15(20)18-12-7-8-24(22,23)9-12/h1-8,12H,9H2,(H,18,20)(H,19,21) |
| InChIKey | YRGBNIIHHNVNDL-UHFFFAOYSA-N |
| SMILES | C1C(C=CS1(=O)=O)NC(=O)C2=CC=C(NC2=O)C3=CC=C(C=C3)F |
| Reference | [1]. Ashely, et al. Cyclic vinyl sulfone compounds as wrn inhibitors. WIPO. 2023-04-20. |
