For research use only. Not for therapeutic Use.
WRN Inhibitor 1 (CAT: I040921) is a selective inhibitor of Werner syndrome protein (WRN), an ATP-dependent helicase enzyme involved in DNA replication, repair, and genomic stability. By inhibiting the helicase activity of WRN, this compound disrupts DNA repair processes, which are critical for cancer cell survival, particularly in tumors with defective DNA repair mechanisms. WRN is often overexpressed in various cancers, making it a promising target for cancer therapy. WRN Inhibitor 1 has significant potential for use in Cancer Disease Research, offering a novel strategy for targeting WRN in cancer cells and exploring its role in tumor progression and resistance to therapies.
| CAS Number | 2923008-44-8 |
| Synonyms | N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-6-(4-fluorophenyl)-2-oxo-1H-pyridine-3-carboxamide |
| Molecular Formula | C16H13FN2O4S |
| Purity | ≥95% |
| IUPAC Name | N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-6-(4-fluorophenyl)-2-oxo-1H-pyridine-3-carboxamide |
| InChI | InChI=1S/C16H13FN2O4S/c17-11-3-1-10(2-4-11)14-6-5-13(16(21)19-14)15(20)18-12-7-8-24(22,23)9-12/h1-8,12H,9H2,(H,18,20)(H,19,21) |
| InChIKey | YRGBNIIHHNVNDL-UHFFFAOYSA-N |
| SMILES | C1C(C=CS1(=O)=O)NC(=O)C2=CC=C(NC2=O)C3=CC=C(C=C3)F |
