For research use only. Not for therapeutic Use.
WRN inhibitor 4 (example 107), a cyclic vinyl sulfone compound, is a Wemer Syndrome ATP dependent helicase enzyme (WRN) inhibitor. WRN inhibitor 4 can be used for the research of cancer[1].
| Catalog Number | I040874 |
| CAS Number | 2923009-45-2 |
| Synonyms | N-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-5-hydroxy-2-oxo-6-phenyl-1H-pyridine-3-carboxamide |
| Molecular Formula | C16H14N2O5S |
| Purity | ≥95% |
| InChI | InChI=1S/C16H14N2O5S/c19-13-8-12(15(20)17-11-6-7-24(22,23)9-11)16(21)18-14(13)10-4-2-1-3-5-10/h1-8,11,19H,9H2,(H,17,20)(H,18,21)/t11-/m1/s1 |
| InChIKey | HFIIQCVNTGZNPC-LLVKDONJSA-N |
| SMILES | C1C(C=CS1(=O)=O)NC(=O)C2=CC(=C(NC2=O)C3=CC=CC=C3)O |
| Reference | [1]. Ashley ADAMS, et al. Cyclic vinyl sulfone compounds as wrn inhibitors. Patent. WO2023062575 A1. |
