For research use only. Not for therapeutic Use.
Cyclohexanecarboxamide（Cat No.:I010653）, also known as Ethyl menthane carboxamide, WS3, or Hexahydrobenzamide, is a cooling agent used in various products. It acts as an agonist of the TRPM8 receptor, which is involved in the perception of cold temperature. Cyclohexanecarboxamide activates the TRPM8 receptor, resulting in a cooling sensation on the skin or mucous membranes. It exhibits an EC50 value of 3.7 μM, indicating its potency in activating the TRPM8 receptor. This property makes it useful in the formulation of cooling and soothing products, such as topical analgesics and personal care items.
| Catalog Number | I010653 |
| CAS Number | 39711-79-0 |
| Synonyms | N-Ethyl-5-methyl-2-(1-methylethyl)cyclohexanecarboxamide |
| Molecular Formula | C13H25NO |
| Purity | ≥95% |
| Solubility | Soluble to 100 mM in DMSO and to 100 mM in ethanol |
| Storage | Room Temperature |
| IUPAC Name | N-ethyl-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide |
| InChI | InChI=1S/C13H25NO/c1-5-14-13(15)12-8-10(4)6-7-11(12)9(2)3/h9-12H,5-8H2,1-4H3,(H,14,15) |
| InChIKey | VUNOFAIHSALQQH-UHFFFAOYSA-N |
| SMILES | CCNC(=O)C1CC(CCC1C(C)C)C |
