For research use only. Not for therapeutic Use.
WT161(Cat No.:R066903)is a potent, selective inhibitor of histone deacetylase 6 (HDAC6), an enzyme involved in regulating protein degradation, cell motility, and immune responses. By inhibiting HDAC6, WT161 disrupts the deacetylation of proteins such as tubulin and heat shock proteins, leading to effects on cancer cell survival, autophagy, and immune modulation. It holds promise for cancer research, especially in multiple myeloma and other hematological malignancies. WT161’s specificity makes it a powerful tool for investigating HDAC6-related pathways and their therapeutic potential in oncology and immune-related diseases.
CAS Number | 1206731-57-8 |
Synonyms | 8-(hydroxyamino)-8-oxo-octanoic acid 2-[[4-(diphenylamino)phenyl]methylene]hydrazide |
Molecular Formula | C27H30N4O3 |
Purity | ≥95% |
Target | Cell Cycle/DNA Damage |
Storage | -20°C |
IUPAC Name | N'-hydroxy-N-[(E)-[4-(N-phenylanilino)phenyl]methylideneamino]octanediamide |
InChI | InChI=1S/C27H30N4O3/c32-26(15-9-1-2-10-16-27(33)30-34)29-28-21-22-17-19-25(20-18-22)31(23-11-5-3-6-12-23)24-13-7-4-8-14-24/h3-8,11-14,17-21,34H,1-2,9-10,15-16H2,(H,29,32)(H,30,33)/b28-21+ |
InChIKey | KXWWYFKVBFUVIZ-SGWCAAJKSA-N |
SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)/C=N/NC(=O)CCCCCCC(=O)NO |