For research use only. Not for therapeutic Use.
WUN37241(Cat No.:I038351)is a small molecule compound under investigation for its potential as a therapeutic agent. It functions primarily as a selective modulator of specific cellular pathways, though its precise mechanism of action is still being explored. Early research suggests that WUN37241 may have applications in treating diseases related to abnormal cell signaling, such as cancer, inflammatory conditions, and metabolic disorders. Its targeted approach aims to reduce side effects by modulating only specific receptors or enzymes involved in disease processes. Further clinical studies are required to assess its safety, efficacy, and potential therapeutic use.
CAS Number | 2515737-24-1 |
Synonyms | Bipiperidinyl 4-ANPP; WUN37241; WUN 37241; WUN-37241; |
Molecular Formula | C24H33N3 |
Purity | 98% |
Solubility | To be determined |
Appearance | Solid powder |
Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
IUPAC Name | N-phenyl-1-[1-(2-phenylethyl)piperidin-4-yl]piperidin-4-amine |
InChI | InChI=1S/C24H33N3/c1-3-7-21(8-4-1)11-16-26-17-14-24(15-18-26)27-19-12-23(13-20-27)25-22-9-5-2-6-10-22/h1-10,23-25H,11-20H2 |
InChIKey | WAXLNNINXFRTDA-UHFFFAOYSA-N |
SMILES | C1CN(CCC1NC2=CC=CC=C2)C3CCN(CC3)CCC4=CC=CC=C4 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |