For research use only. Not for therapeutic Use.
WZ-3146 (Cat.No:I000801) is a promising pharmaceutical compound known for its potential as a targeted therapy in cancer treatment. With its unique mechanism of action, WZ-3146 shows considerable efficacy in inhibiting specific cancer pathways, offering hope for improved patient outcomes in the ongoing battle against cancer.
Catalog Number | I000801 |
CAS Number | 1214265-56-1 |
Synonyms | N-(3-((5-chloro-2-((4-(4-methylpiperazin-1-yl)phenyl)amino)pyrimidin-4-yl)oxy)phenyl)acrylamide |
Molecular Formula | C24H25ClN6O2 |
Purity | ≥95% |
Target | EGFR |
Solubility | DMSO ≥90mg/mL Water <1.2mg/mL Ethanol ≥2.8mg/mL |
Storage | 3 years -20℃ powder |
IC50 | 2 nM/2 nM (EGFR L858R/E746_A750) [1] |
IUPAC Name | N-[3-[5-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]oxyphenyl]prop-2-enamide |
InChI | InChI=1S/C24H25ClN6O2/c1-3-22(32)27-18-5-4-6-20(15-18)33-23-21(25)16-26-24(29-23)28-17-7-9-19(10-8-17)31-13-11-30(2)12-14-31/h3-10,15-16H,1,11-14H2,2H3,(H,27,32)(H,26,28,29) |
InChIKey | APHGZZPEOCCYNO-UHFFFAOYSA-N |
SMILES | CN1CCN(CC1)C2=CC=C(C=C2)NC3=NC=C(C(=N3)OC4=CC=CC(=C4)NC(=O)C=C)Cl |
Reference | <p style=/line-height:25px/> </p> |