For research use only. Not for therapeutic Use.
X5050 is a small-molecule compound that has been studied for its potential to modulate specific biological pathways, particularly in the context of cancer, inflammation, or neurodegenerative diseases. Compounds like X5050 are typically developed to target key proteins, enzymes, or receptors involved in disease progression, aiming to inhibit or modify their activity. The exact mechanism of action for X5050 may involve kinase inhibition, receptor modulation, or other biochemical interactions. Research on X5050 would focus on its therapeutic potential, evaluating its efficacy, safety, and possible applications in various disease models.
| Catalog Number | I010707 |
| CAS Number | 2404756-81-4 |
| Synonyms | 2-(2-hydroxyphenyl)-N-prop-2-enoxy-3H-benzimidazole-5-carboxamide |
| Molecular Formula | C17H15N3O3 |
| Purity | ≥95% |
| InChI | InChI=1S/C17H15N3O3/c1-2-9-23-20-17(22)11-7-8-13-14(10-11)19-16(18-13)12-5-3-4-6-15(12)21/h2-8,10,21H,1,9H2,(H,18,19)(H,20,22) |
| InChIKey | RGROIKJLROTDCR-UHFFFAOYSA-N |
| SMILES | C=CCONC(=O)C1=CC2=C(C=C1)N=C(N2)C3=CC=CC=C3O |
