For research use only. Not for therapeutic Use.
Xanthatin (Cat No.:R038352) is a sesquiterpene lactone found in the plant Xanthium strumarium (cocklebur). This natural compound exhibits diverse biological activities, including anti-inflammatory, antitumor, and antiviral effects. It has shown promise in inhibiting cancer cell growth and displaying antiviral activity against certain viruses. As a bioactive compound, Xanthatin holds potential for medical applications, but further research is needed to fully understand its mechanisms of action, safety, and potential therapeutic uses in various fields.
CAS Number | 26791-73-1 |
Molecular Formula | C15H18O3 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | (3aR,7S,8aS)-7-methyl-3-methylidene-6-[(E)-3-oxobut-1-enyl]-4,7,8,8a-tetrahydro-3aH-cyclohepta[b]furan-2-one |
InChI | InChI=1S/C15H18O3/c1-9-8-14-13(11(3)15(17)18-14)7-6-12(9)5-4-10(2)16/h4-6,9,13-14H,3,7-8H2,1-2H3/b5-4+/t9-,13+,14-/m0/s1 |
InChIKey | RBRPTFMVULVGIC-ZTIIIDENSA-N |
SMILES | CC1CC2C(CC=C1C=CC(=O)C)C(=C)C(=O)O2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |