For research use only. Not for therapeutic Use.
Xanthine amine congener hydrochloride (Cat No.:I043602) is a synthetic compound primarily used in biomedical research for its ability to inhibit protein-protein interactions, particularly in the context of G-protein coupled receptors (GPCRs). XAC is known to block adenosine receptors, making it a valuable tool in studies related to inflammation, cardiovascular diseases, and neurological disorders. As a hydrochloride salt, it offers improved stability and solubility for in vitro applications. Researchers are exploring its potential in modulating various cellular pathways, particularly for its therapeutic implications in metabolic and neurodegenerative diseases.
| CAS Number | 1783977-95-6 |
| Synonyms | N-(2-aminoethyl)-2-[4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)phenoxy]acetamide;hydrochloride |
| Molecular Formula | C21H29ClN6O4 |
| Purity | ≥95% |
| IUPAC Name | N-(2-aminoethyl)-2-[4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)phenoxy]acetamide;hydrochloride |
| InChI | InChI=1S/C21H28N6O4.ClH/c1-3-11-26-19-17(20(29)27(12-4-2)21(26)30)24-18(25-19)14-5-7-15(8-6-14)31-13-16(28)23-10-9-22;/h5-8H,3-4,9-13,22H2,1-2H3,(H,23,28)(H,24,25);1H |
| InChIKey | IVOSTHCDPHGPAS-UHFFFAOYSA-N |
| SMILES | CCCN1C2=C(C(=O)N(C1=O)CCC)NC(=N2)C3=CC=C(C=C3)OCC(=O)NCCN.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
