For research use only. Not for therapeutic Use.
Xanthone(Cat No.:R040298)is an organic compound characterized by a dibenzo-γ-pyrone structure, widely found in various plants, fungi, and lichens. It serves as the core scaffold for numerous natural derivatives known for their diverse biological activities, including antioxidant, anti-inflammatory, anti-cancer, and antimicrobial properties. Xanthones have garnered significant interest in pharmaceutical research due to their potential therapeutic applications. Their ability to interact with multiple biological targets makes them valuable in drug discovery and development. Additionally, xanthones are used in traditional medicine and are being studied for their benefits in treating various diseases.
CAS Number | 90-47-1 |
Synonyms | 9H-Xanthen-9-one; Xanthen-9-one; 9-Oxoxanthene; 9-Xanthone; 9-Oxo-9H-xanthene; Benzophenone Oxide; Dibenzo-γ-pyrone; Diphenylene Ketone Oxide; Genicide; NSC 14978; Xanthenone; Xanthone |
Molecular Formula | C13H8O2 |
Purity | ≥95% |
Target | Apoptosis |
Storage | 3 years -20C powder |
IUPAC Name | xanthen-9-one |
InChI | InChI=1S/C13H8O2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8H |
InChIKey | JNELGWHKGNBSMD-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(=O)C3=CC=CC=C3O2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |