For research use only. Not for therapeutic Use.
Xanthorrhizol(Cat No.:R017674)is a natural sesquiterpene compound isolated from the rhizomes of Curcuma xanthorrhiza, a plant used in traditional medicine. It exhibits a range of pharmacological activities, including antioxidant, anti-inflammatory, antimicrobial, and anticancer properties. Xanthorrhizol has shown potential in inhibiting tumor growth and modulating immune responses, making it a promising candidate for cancer therapy and inflammatory disease management. Additionally, its antimicrobial effects suggest potential use in treating infections. Xanthorrhizol’s bioactivity is attributed to its ability to interact with various signaling pathways and cellular targets.
CAS Number | 30199-26-9 |
Synonyms | (-)-Xanthorrhizol; (-)-Xanthorrizol; (R)-(-)-Xanthorrhizol; (R)-(-)-Xanthorrizol; (R)-5-(1,5-Dimethyl-4-hexenyl)-o-cresol; (-)-5-(1,5-Dimethyl-4-hexenyl)-o-cresol; 5-[(1R)-1,5-Dimethyl-4-hexenyl]-2-methylphenol; (R)-5-(1,5-Dimethyl-4-hexenyl)-2-met |
Molecular Formula | C15H22O |
Purity | ≥95% |
Target | Bacterial |
Storage | -20°C |
IUPAC Name | 2-methyl-5-[(2R)-6-methylhept-5-en-2-yl]phenol |
InChI | InChI=1S/C15H22O/c1-11(2)6-5-7-12(3)14-9-8-13(4)15(16)10-14/h6,8-10,12,16H,5,7H2,1-4H3/t12-/m1/s1 |
InChIKey | FKWGCEDRLNNZOZ-GFCCVEGCSA-N |
SMILES | CC1=C(C=C(C=C1)[C@H](C)CCC=C(C)C)O |