Xanthosine-13C5（Cat No.:R022587）, is a stable isotope-labeled compound used in biochemical and analytical research. It is structurally similar to xanthosine, a naturally occurring purine nucleoside found in RNA. The “13C5” designation indicates that five carbon atoms in the compound have been replaced with the stable isotope carbon-13, which can be used in nuclear magnetic resonance (NMR) spectroscopy and mass spectrometry experiments for tracking and elucidating metabolic pathways and studying RNA structures.
| Catalog Number | R022587 |
| CAS Number | 146-80-5 |
| Synonyms | 3,9-Dihydro-9-β-D-ribofuranosyl-1H-purine-2,6-dione-13C5; Xanthine Riboside;-13C5 9-β-D-Ribofuranosylxanthine-13C5; NSC 18930-13C5; Xanthine-9 β-D-Ribofuranoside-13C5 |
| Molecular Formula | C10H12N4O6 |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purine-2,6-dione |
| InChI | InChI=1S/C10H12N4O6/c15-1-3-5(16)6(17)9(20-3)14-2-11-4-7(14)12-10(19)13-8(4)18/h2-3,5-6,9,15-17H,1H2,(H2,12,13,18,19)/t3-,5-,6-,9-/m1/s1 |
| InChIKey | UBORTCNDUKBEOP-UUOKFMHZSA-N |
| SMILES | C1=NC2=C(N1C3C(C(C(O3)CO)O)O)NC(=O)NC2=O |
