For research use only. Not for therapeutic Use.
XAV939 (Cat No.: I002965) is a small molecule inhibitor primarily used in research to block the Wnt/β-catenin signaling pathway, which plays a critical role in cell growth, differentiation, and cancer progression. By inhibiting tankyrase enzymes, XAV939 prevents the stabilization of β-catenin, thereby suppressing the Wnt signaling pathway. This compound has shown potential in cancer research, particularly in targeting cancers with dysregulated Wnt signaling, and is also being explored for its therapeutic potential in diseases like colorectal cancer and other Wnt-related disorders.
| CAS Number | 284028-89-3 |
| Synonyms | 2-[4-(trifluoromethyl)phenyl]-1,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-4-one |
| Molecular Formula | C₁₄H₁₁F₃N₂OS |
| Purity | ≥95% |
| Target | Epigenetics |
| Solubility | DMSO: ≤ 21.5 mg/mL |
| Storage | 3 years -20C powder |
| IC50 | 11 nM(TNKS1); 4 nM(TNKS2) |
| InChI | InChI=1S/C14H11F3N2OS/c15-14(16,17)9-3-1-8(2-4-9)12-18-11-5-6-21-7-10(11)13(20)19-12/h1-4H,5-7H2,(H,18,19,20) |
| InChIKey | KLGQSVMIPOVQAX-UHFFFAOYSA-N |
| SMILES | C1CSCC2=C1NC(=NC2=O)C3=CC=C(C=C3)C(F)(F)F |
| Reference | <p> |
