For research use only. Not for therapeutic Use.
Xylene（Cat No.:R022702）is a high-purity aromatic hydrocarbon widely used in industrial and laboratory applications. It serves as a solvent in the production of paints, coatings, adhesives, and rubber, due to its excellent solvency properties. In the chemical industry, xylene is a key raw material for manufacturing terephthalic acid and dimethyl terephthalate, which are essential for polyester production. It is also utilized in histology as a clearing agent for tissue sample preparation. Xylene’s versatility and effectiveness make it indispensable in various manufacturing processes, research, and diagnostic applications.
| Catalog Number | R022702 |
| CAS Number | 1330-20-7 |
| Synonyms | Dimethylbenzene; Entellan New; Xylol; ZEP-RD; |
| Molecular Formula | C₈H₁₀ |
| Purity | ≥95% |
| IUPAC Name | 1,3-xylene |
| InChI | InChI=1S/C8H10/c1-7-4-3-5-8(2)6-7/h3-6H,1-2H3 |
| InChIKey | IVSZLXZYQVIEFR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C |
