For research use only. Not for therapeutic Use.
Xylyl Bromide(CAT: I038490) is a halogenated aromatic compound consisting of a xylyl group attached to a bromine atom. This pale yellow liquid was historically used as a lachrymatory agent during chemical warfare due to its irritant properties, causing severe eye and mucous membrane irritation. Today, Xylyl Bromide is primarily employed in chemical synthesis and research as an intermediate for producing dyes, pharmaceuticals, and other organic compounds. Its high reactivity makes it valuable for studying halogenated aromatic reactions and transformations. However, it requires careful handling due to its toxic and irritant nature, ensuring safe use in laboratory environments.
CAS Number | 35884-77-6 |
Synonyms | Xylyl bromide |
Molecular Formula | C8H9Br |
Purity | 98% |
Solubility | Soluble in DMSO |
Appearance | Solid powder |
Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
IUPAC Name | 2-bromo-1,4-dimethylbenzene |
InChI | InChI=1S/C8H9Br/c1-6-4-3-5-8(9)7(6)2/h3-5H,1-2H3 |
InChIKey | WLPXNBYWDDYJTN-UHFFFAOYSA-N |
SMILES | CC1=CC=CC(Br)=C1C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |