For research use only. Not for therapeutic Use.
XZ45 is a novel HIV Integrase Inhibitor, significantly inhibiting HSV-1 and HSV-2 replication in different cell types, blocking HSV viral DNA replication and late gene expression, also inhibiting viral recombination in infected cells and ICP8 recombinase activity.
| Catalog Number | I038497 |
| Synonyms | XZ45; XZ-45; XZ 45 |
| Molecular Formula | C14H12N2O5 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 2,3-Dihydroxy-N'-(2-hydroxybenzoyl)benzohydrazide |
| InChI | InChI=1S/C14H12N2O5/c17-10-6-2-1-4-8(10)13(20)15-16-14(21)9-5-3-7-11(18)12(9)19/h1-7,17-19H,(H,15,20)(H,16,21) |
| InChIKey | DNCBPZLOUZEIIO-UHFFFAOYSA-N |
| SMILES | O=C(NNC(C1=CC=CC=C1O)=O)C2=CC=CC(O)=C2O |
