For research use only. Not for therapeutic Use.
Y-27632 Dihydrochloride Hydrate(Cat No.:R008461), is a chemical compound commonly used in biological and pharmacological research. It is a selective inhibitor of the Rho-associated protein kinase (ROCK), which plays a crucial role in various cellular processes such as cell migration, smooth muscle contraction, and cytoskeleton organization. By inhibiting ROCK, Y-27632 Dihydrochloride Hydrate can modulate these cellular functions. This compound has been studied extensively for its potential therapeutic applications, including in the treatment of diseases related to abnormal cell motility and contractility, such as glaucoma and certain cardiovascular disorders.
CAS Number | 331752-47-7 |
Synonyms | trans-4-[(1R)-1-Aminoethyl]-N-4-pyridinyl-cyclohexanecarboxamide Dihydrochloride Monohydrate; (R)-(+)-trans-4-(1-Aminoethyl)-N-(4-pyridyl)cyclohexanecarboxamide Dihydrochloride Monohydrate; |
Molecular Formula | C₁₄H₂₅Cl₂N₃O₂ |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-[(1R)-1-aminoethyl]-N-pyridin-4-ylcyclohexane-1-carboxamide;hydrate;dihydrochloride |
InChI | InChI=1S/C14H21N3O.2ClH.H2O/c1-10(15)11-2-4-12(5-3-11)14(18)17-13-6-8-16-9-7-13;;;/h6-12H,2-5,15H2,1H3,(H,16,17,18);2*1H;1H2/t10-,11?,12?;;;/m1.../s1 |
InChIKey | BLQHLDXMMWHXIT-UYRCGDKNSA-N |
SMILES | CC(C1CCC(CC1)C(=O)NC2=CC=NC=C2)N.O.Cl.Cl |